1-[2-(2-hydroxyethylamino)ethylamino]-4-methyl-thioxanthen-9-one structure
|
Common Name | 1-[2-(2-hydroxyethylamino)ethylamino]-4-methyl-thioxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 69895-71-2 | Molecular Weight | 328.42900 | |
| Density | 1.294g/cm3 | Boiling Point | 579ºC at 760 mmHg | |
| Molecular Formula | C18H20N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.9ºC | |
| Name | 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylthioxanthen-9-one |
|---|
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 579ºC at 760 mmHg |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.42900 |
| Flash Point | 303.9ºC |
| Exact Mass | 328.12500 |
| PSA | 89.60000 |
| LogP | 3.18080 |
| Index of Refraction | 1.677 |
| InChIKey | QDICDDBHUNGLMP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NCCNCCO)c2c(=O)c3ccccc3sc12 |
|
~%
1-[2-(2-hydroxy... CAS#:69895-71-2 |
| Literature: Archer; Suter Journal of the American Chemical Society, 1952 , vol. 74, p. 4296,4301 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |