2,3-Quinoxalinedione,6-amino-1,4-dihydro-7-methyl-(9CI) structure
|
Common Name | 2,3-Quinoxalinedione,6-amino-1,4-dihydro-7-methyl-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 69904-14-9 | Molecular Weight | 191.18700 | |
| Density | 1.524g/cm3 | Boiling Point | 563.239ºC at 760 mmHg | |
| Molecular Formula | C9H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.437ºC | |
| Name | 6-amino-7-methyl-1,4-dihydroquinoxaline-2,3-dione |
|---|
| Density | 1.524g/cm3 |
|---|---|
| Boiling Point | 563.239ºC at 760 mmHg |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.18700 |
| Flash Point | 294.437ºC |
| Exact Mass | 191.06900 |
| PSA | 91.74000 |
| LogP | 0.68820 |
| Index of Refraction | 1.79 |
| InChIKey | FWTQHXAYMVYHKX-UHFFFAOYSA-N |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1N |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |