Benzene,[2,2-bis(methylsulfonyl)ethenyl]- structure
|
Common Name | Benzene,[2,2-bis(methylsulfonyl)ethenyl]- | ||
|---|---|---|---|---|
| CAS Number | 69914-27-8 | Molecular Weight | 260.33000 | |
| Density | 1.378g/cm3 | Boiling Point | 547.7ºC at 760mmHg | |
| Molecular Formula | C10H12O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 379.8ºC | |
| Name | 2,2-bis(methylsulfonyl)ethenylbenzene |
|---|
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 547.7ºC at 760mmHg |
| Molecular Formula | C10H12O4S2 |
| Molecular Weight | 260.33000 |
| Flash Point | 379.8ºC |
| Exact Mass | 260.01800 |
| PSA | 85.04000 |
| LogP | 3.23580 |
| Index of Refraction | 1.577 |
| InChIKey | XWVQTHWHWJLLSG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C(=Cc1ccccc1)S(C)(=O)=O |
|
~%
Benzene,[2,2-bi... CAS#:69914-27-8 |
| Literature: Yamashita,M. et al. Bulletin of the Chemical Society of Japan, 1979 , vol. 52, # 2 p. 466 - 468 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |