6-bromo-3-phenyl-1,2,4-benzotriazine
6-bromo-3-phenyl-1,2,4-benzotriazine structure
|
Common Name | 6-bromo-3-phenyl-1,2,4-benzotriazine | ||
|---|---|---|---|---|
| CAS Number | 69918-17-8 | Molecular Weight | 286.12700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8BrN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-bromo-3-phenyl-1,2,4-benzotriazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H8BrN3 |
|---|---|
| Molecular Weight | 286.12700 |
| Exact Mass | 284.99000 |
| PSA | 38.67000 |
| LogP | 3.45430 |
| InChIKey | YCRBXZCLASQJEI-UHFFFAOYSA-N |
| SMILES | Brc1ccc2nnc(-c3ccccc3)nc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-bromo-3-pheny... CAS#:69918-17-8 |
| Literature: Khodja, Mohamed; Moulay, Saad; Boutoumi, Hocine; Wilde, Horst Heteroatom Chemistry, 2006 , vol. 17, # 2 p. 166 - 172 |
|
~%
6-bromo-3-pheny... CAS#:69918-17-8 |
| Literature: Khodja, Mohamed; Moulay, Saad; Boutoumi, Hocine; Wilde, Horst Heteroatom Chemistry, 2006 , vol. 17, # 2 p. 166 - 172 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2,4-Benzotriazine,6-bromo-3-phenyl |
| 6-bromo-3-phenyl-benzo[e][1,2,4]triazine |
| 6-bromo-3-phenyl-[1,2,4]benzotriazine |
| 6-Brom-3-phenyl-1,2,4-benzotriazin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-bromo-3-phenyl-1,2,4-benzotriazine? |
| A: InChIKey of 6-bromo-3-phenyl-1,2,4-benzotriazine is YCRBXZCLASQJEI-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 6-bromo-3-phenyl-1,2,4-benzotriazine? |
| A: Related upstream materials(CAS) of 6-bromo-3-phenyl-1,2,4-benzotriazine: 59488-34-5;825-60-5. |
| Q: What is the SMILES notation of 6-bromo-3-phenyl-1,2,4-benzotriazine? |
| A: SMILES notation of 6-bromo-3-phenyl-1,2,4-benzotriazine is Brc1ccc2nnc(-c3ccccc3)nc2c1. |
| Q: What is the CAS number of 6-bromo-3-phenyl-1,2,4-benzotriazine? |
| A: CAS number of 6-bromo-3-phenyl-1,2,4-benzotriazine is 69918-17-8. |
| Q: What is the molecular formula of 6-bromo-3-phenyl-1,2,4-benzotriazine? |
| A: Molecular formula of 6-bromo-3-phenyl-1,2,4-benzotriazine is C13H8BrN3. |
| Q: What English synonyms does 6-bromo-3-phenyl-1,2,4-benzotriazine have? |
| A: English synonyms of 6-bromo-3-phenyl-1,2,4-benzotriazine: 1,2,4-Benzotriazine,6-bromo-3-phenyl, 6-bromo-3-phenyl-benzo[e][1,2,4]triazine, 6-bromo-3-phenyl-[1,2,4]benzotriazine, 6-Brom-3-phenyl-1,2,4-benzotriazin. |
| Q: What is the English name of 6-bromo-3-phenyl-1,2,4-benzotriazine? |
| A: The English name of 6-bromo-3-phenyl-1,2,4-benzotriazine is 6-bromo-3-phenyl-1,2,4-benzotriazine. |
| Q: What is the molecular weight of 6-bromo-3-phenyl-1,2,4-benzotriazine? |
| A: Molecular weight of 6-bromo-3-phenyl-1,2,4-benzotriazine is 286.12700. |
| Q: What is the LogP of 6-bromo-3-phenyl-1,2,4-benzotriazine? |
| A: LogP of 6-bromo-3-phenyl-1,2,4-benzotriazine is 3.45430. |
| Q: What is the polar surface area (PSA) of 6-bromo-3-phenyl-1,2,4-benzotriazine? |
| A: Polar surface area (PSA) of 6-bromo-3-phenyl-1,2,4-benzotriazine is 38.67000. |