4-diphenylphosphoryl-3-methylpentan-2-one
4-diphenylphosphoryl-3-methylpentan-2-one structure
|
Common Name | 4-diphenylphosphoryl-3-methylpentan-2-one | ||
|---|---|---|---|---|
| CAS Number | 69930-77-4 | Molecular Weight | 300.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-diphenylphosphoryl-3-methylpentan-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21O2P |
|---|---|
| Molecular Weight | 300.33200 |
| Exact Mass | 300.12800 |
| PSA | 43.95000 |
| LogP | 3.61410 |
| InChIKey | GDLUJAPGRPBZJT-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)C(C)P(=O)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~80%
4-diphenylphosp... CAS#:69930-77-4 |
| Literature: Bell, Andrew; Davidson, Alan H.; Earnshaw, Chris; Norrish, Howard K.; Torr, Richard S.; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2879 - 2892 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Pentanone,4-(diphenylphosphinyl)-3-methyl |
| 4-diphenylphosphinoyl-3-methylpentan-2-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-diphenylphosphoryl-3-methylpentan-2-one have? |
| A: English synonyms of 4-diphenylphosphoryl-3-methylpentan-2-one: 2-Pentanone,4-(diphenylphosphinyl)-3-methyl, 4-diphenylphosphinoyl-3-methylpentan-2-one. |
| Q: What is the LogP of 4-diphenylphosphoryl-3-methylpentan-2-one? |
| A: LogP of 4-diphenylphosphoryl-3-methylpentan-2-one is 3.61410. |
| Q: What is the CAS number of 4-diphenylphosphoryl-3-methylpentan-2-one? |
| A: CAS number of 4-diphenylphosphoryl-3-methylpentan-2-one is 69930-77-4. |
| Q: What is the Chinese name of 69930-77-4? |
| A: Chinese name of 69930-77-4 is 69930-77-4. |
| Q: What is the molecular formula of 4-diphenylphosphoryl-3-methylpentan-2-one? |
| A: Molecular formula of 4-diphenylphosphoryl-3-methylpentan-2-one is C18H21O2P. |
| Q: What is the SMILES notation of 4-diphenylphosphoryl-3-methylpentan-2-one? |
| A: SMILES notation of 4-diphenylphosphoryl-3-methylpentan-2-one is CC(=O)C(C)C(C)P(=O)(c1ccccc1)c1ccccc1. |
| Q: What are the upstream materials of 4-diphenylphosphoryl-3-methylpentan-2-one? |
| A: Related upstream materials(CAS) of 4-diphenylphosphoryl-3-methylpentan-2-one: 69930-76-3. |
| Q: What is the InChIKey of 4-diphenylphosphoryl-3-methylpentan-2-one? |
| A: InChIKey of 4-diphenylphosphoryl-3-methylpentan-2-one is GDLUJAPGRPBZJT-UHFFFAOYSA-N. |
| Q: What is the English name of 4-diphenylphosphoryl-3-methylpentan-2-one? |
| A: The English name of 4-diphenylphosphoryl-3-methylpentan-2-one is 4-diphenylphosphoryl-3-methylpentan-2-one. |
| Q: What is the molecular weight of 4-diphenylphosphoryl-3-methylpentan-2-one? |
| A: Molecular weight of 4-diphenylphosphoryl-3-methylpentan-2-one is 300.33200. |