2,6-Dimethyl-3-nitrophenol
Modify Date: 2025-08-22 18:08:19
2,6-Dimethyl-3-nitrophenol structure
|
Common Name | 2,6-Dimethyl-3-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 6994-63-4 | Molecular Weight | 167.162 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 292.4±28.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9±12.5 °C | |
| Name | 2,6-Dimethyl-3-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 292.4±28.0 °C at 760 mmHg |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Flash Point | 129.9±12.5 °C |
| Exact Mass | 167.058243 |
| PSA | 66.05000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | TZASZCQVZPLXHP-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(C)c1O |
| HS Code | 2908999090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:6994-64-5
CAS#:50536-74-8| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-Nitro-2-oxy-1.3-dimethyl-benzol |
| EINECS 230-267-0 |
| 2,6-Dimethyl-3-nitrophenol |
| 3-Nitro-vic.-m-xylenol |
| 2,6-dimethyl-3-nitro phenol |
| 3-nitro-2,6-xylenol |