tris(p-tert-pentylphenyl) phosphite, compound with dicyclohexylamine (1:1) structure
|
Common Name | tris(p-tert-pentylphenyl) phosphite, compound with dicyclohexylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 69943-67-5 | Molecular Weight | 702.000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H68NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Tris[4-(2-methyl-2-butanyl)phenyl] phosphite-N-cyclohexylcyclohexanamine (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C45H68NO3P |
|---|---|
| Molecular Weight | 702.000 |
| Exact Mass | 701.493652 |
| InChIKey | HBLBZUZADOHOCB-UHFFFAOYSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CCC(C)(C)c1ccc(OP(Oc2ccc(C(C)(C)CC)cc2)Oc2ccc(C(C)(C)CC)cc2)cc1 |
| Tris[4-(2-methyl-2-butanyl)phenyl] phosphite - N-cyclohexylcyclohexanamine (1:1) |
| EINECS 274-231-2 |