2-Pyrimidinamine,4,4'-dithiobis[6-methyl
2-Pyrimidinamine,4,4'-dithiobis[6-methyl structure
|
Common Name | 2-Pyrimidinamine,4,4'-dithiobis[6-methyl | ||
|---|---|---|---|---|
| CAS Number | 69945-13-7 | Molecular Weight | 280.37200 | |
| Density | 1.48g/cm3 | Boiling Point | 595.2ºC at 760 mmHg | |
| Molecular Formula | C10H12N6S2 | Melting Point | 208ºC | |
| MSDS | N/A | Flash Point | 313.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 595.2ºC at 760 mmHg |
| Melting Point | 208ºC |
| Molecular Formula | C10H12N6S2 |
| Molecular Weight | 280.37200 |
| Flash Point | 313.7ºC |
| Exact Mass | 280.05600 |
| PSA | 154.20000 |
| LogP | 3.00960 |
| Index of Refraction | 1.729 |
| InChIKey | CLAPOZGLYFFUHA-UHFFFAOYSA-N |
| SMILES | Cc1cc(SSc2cc(C)nc(N)n2)nc(N)n1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933599090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-[(2-amino-6-methylpyrimidin-4-yl)disulfanyl]-6-methylpyrimidin-2-amine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide? |
| A: LogP of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide is 3.00960. |
| Q: What is the molecular formula of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide? |
| A: Molecular formula of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide is C10H12N6S2. |
| Q: What is the polar surface area (PSA) of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide? |
| A: Polar surface area (PSA) of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide is 154.20000. |
| Q: What is the boiling point of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide? |
| A: Boiling point of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide is 595.2ºC at 760 mmHg. |
| Q: What is the CAS number of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide? |
| A: CAS number of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide is 69945-13-7. |
| Q: What is the InChIKey of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide? |
| A: InChIKey of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide is CLAPOZGLYFFUHA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide? |
| A: Molecular weight of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide is 280.37200. |
| Q: What English synonyms does 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide have? |
| A: English synonyms of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide: 4-[(2-amino-6-methylpyrimidin-4-yl)disulfanyl]-6-methylpyrimidin-2-amine. |
| Q: What is the melting point of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide? |
| A: Melting point of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide is 208ºC. |
| Q: What is the English name of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide? |
| A: The English name of 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide is 4,4'-Bis(2-amino-6-methylpyrimidyl) Disulfide. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |