4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane structure
|
Common Name | 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 69964-34-7 | Molecular Weight | 186.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H18O2Si |
|---|---|
| Molecular Weight | 186.32400 |
| Exact Mass | 186.10800 |
| PSA | 18.46000 |
| LogP | 2.90180 |
| InChIKey | FZZHEPOIWMYOJL-UHFFFAOYSA-N |
| SMILES | C=C(C=C(C)OC)O[Si](C)(C)C |
|
~%
4-methoxypenta-... CAS#:69964-34-7 |
| Literature: Roberge,G.; Brassard,P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 1041 - 1046 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Silane,[(3-methoxy-1-methylene-2-butenyl)oxy]trimethyl |
| 4-methoxy-2-(trimethylsiloxy)-1,3-pentadiene |
| (E/Z)-4-Methoxy-2-trimethylsiloxypenta-1,3-dien |