4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane
4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane structure
|
Common Name | 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 69964-34-7 | Molecular Weight | 186.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H18O2Si |
|---|---|
| Molecular Weight | 186.32400 |
| Exact Mass | 186.10800 |
| PSA | 18.46000 |
| LogP | 2.90180 |
| InChIKey | FZZHEPOIWMYOJL-UHFFFAOYSA-N |
| SMILES | C=C(C=C(C)OC)O[Si](C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-methoxypenta-... CAS#:69964-34-7 |
| Literature: Roberge,G.; Brassard,P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 1041 - 1046 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:69122-32-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Silane,[(3-methoxy-1-methylene-2-butenyl)oxy]trimethyl |
| 4-methoxy-2-(trimethylsiloxy)-1,3-pentadiene |
| (E/Z)-4-Methoxy-2-trimethylsiloxypenta-1,3-dien |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane? |
| A: LogP of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane is 2.90180. |
| Q: What English synonyms does 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane have? |
| A: English synonyms of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane: Silane,[(3-methoxy-1-methylene-2-butenyl)oxy]trimethyl, 4-methoxy-2-(trimethylsiloxy)-1,3-pentadiene, (E/Z)-4-Methoxy-2-trimethylsiloxypenta-1,3-dien. |
| Q: What is the English name of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane? |
| A: The English name of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane is 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane. |
| Q: What are the upstream materials of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane? |
| A: Related upstream materials(CAS) of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane: 123-54-6. |
| Q: What is the molecular weight of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane? |
| A: Molecular weight of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane is 186.32400. |
| Q: What are the downstream products of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane? |
| A: Related downstream products(CAS) of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane: 69122-32-3. |
| Q: What is the InChIKey of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane? |
| A: InChIKey of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane is FZZHEPOIWMYOJL-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane? |
| A: SMILES notation of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane is C=C(C=C(C)OC)O[Si](C)(C)C. |
| Q: What is the polar surface area (PSA) of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane? |
| A: Polar surface area (PSA) of 4-methoxypenta-1,3-dien-2-yloxy(trimethyl)silane is 18.46000. |
| Q: What is the Chinese name of 69964-34-7? |
| A: Chinese name of 69964-34-7 is 69964-34-7. |