propan-2-yl 3,4-dimethyl-6-(3-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate structure
|
Common Name | propan-2-yl 3,4-dimethyl-6-(3-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6998-34-1 | Molecular Weight | 349.40500 | |
| Density | 1.32g/cm3 | Boiling Point | 455ºC at 760mmHg | |
| Molecular Formula | C16H19N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229ºC | |
| Name | propan-2-yl 3,4-dimethyl-6-(3-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 455ºC at 760mmHg |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.40500 |
| Flash Point | 229ºC |
| Exact Mass | 349.11000 |
| PSA | 126.52000 |
| LogP | 2.98940 |
| Index of Refraction | 1.623 |
| InChIKey | PZQGPAYAWRKNOI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2cccc([N+](=O)[O-])c2)NC(=S)N1C |
|
~%
propan-2-yl 3,4... CAS#:6998-34-1 |
| Literature: Rai,C.; Braunwarth,J.B. Journal of Organic Chemistry, 1961 , vol. 26, p. 3434 - 3436 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1.6-Bis-<benzthiazolyl-(2)>-hexan |
| 2,2'-hexane-1,6-diyl-bis-benzothiazole |