3,3'-diiodothyronine structure
|
Common Name | 3,3'-diiodothyronine | ||
|---|---|---|---|---|
| CAS Number | 70-40-6 | Molecular Weight | 525.07700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13I2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3'-diiodothyronine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13I2NO4 |
|---|---|
| Molecular Weight | 525.07700 |
| Exact Mass | 524.89300 |
| PSA | 92.78000 |
| LogP | 4.04840 |
| InChIKey | CPCJBZABTUOGNM-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccc(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,3'-Diiodothyronine |