2-[2-[4-(diethylamino)phenyl]ethenyl]-6-methylpyran-4-one structure
|
Common Name | 2-[2-[4-(diethylamino)phenyl]ethenyl]-6-methylpyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 70038-33-4 | Molecular Weight | 283.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-[4-(diethylamino)phenyl]ethenyl]-6-methylpyran-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H21NO2 |
|---|---|
| Molecular Weight | 283.36500 |
| Exact Mass | 283.15700 |
| PSA | 33.45000 |
| LogP | 3.96480 |
| InChIKey | ZCPXXTFZJILCKF-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C=Cc2cc(=O)cc(C)o2)cc1 |
|
~%
2-[2-[4-(diethy... CAS#:70038-33-4 |
| Literature: Wiley et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 5102,5104 |
|
~%
2-[2-[4-(diethy... CAS#:70038-33-4 |
| Literature: Wiley et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 5102,5104 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4H-Pyran-4-one,2-[2-[4-(diethylamino)phenyl]ethenyl]-6-methyl |