3,5-dibromo-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-2-hydroxybenzamide structure
|
Common Name | 3,5-dibromo-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-2-hydroxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 7006-96-4 | Molecular Weight | 562.25500 | |
| Density | 1.893g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H14Br2N4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dibromo-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-2-hydroxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.893g/cm3 |
|---|---|
| Molecular Formula | C17H14Br2N4O4S2 |
| Molecular Weight | 562.25500 |
| Exact Mass | 559.88200 |
| PSA | 157.90000 |
| LogP | 5.61100 |
| Index of Refraction | 1.717 |
| InChIKey | WWAURKDWOJDEPH-UHFFFAOYSA-N |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cc(Br)cc(Br)c3O)cc2)s1 |
|
~%
3,5-dibromo-N-[... CAS#:7006-96-4 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society [Section] C: Organic, 1969 , p. 2813 - 2819 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methyl-m-tolyl-amidophosphorsaeure-dimethylester |