n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine
Modify Date: 2025-09-12 01:57:33
![n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine Structure](https://www.chemsrc.com/extcaspic/319/700809-46-7.png)
n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine structure
|
Common Name | n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine | ||
|---|---|---|---|---|
| CAS Number | 700809-46-7 | Molecular Weight | 266.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14N6 |
|---|---|
| Molecular Weight | 266.30 |
| InChIKey | DEXMYNHHTSMJMO-UHFFFAOYSA-N |
| SMILES | Nc1nc(NCc2ccccc2)nn1-c1ccccn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine? |
| A: CAS number of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine is 700809-46-7. |
| Q: What is the InChIKey of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine? |
| A: InChIKey of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine is DEXMYNHHTSMJMO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine? |
| A: SMILES notation of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine is Nc1nc(NCc2ccccc2)nn1-c1ccccn1. |
| Q: What is the molecular weight of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine? |
| A: Molecular weight of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine is 266.30. |
| Q: What is the molecular formula of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine? |
| A: Molecular formula of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine is C14H14N6. |
| Q: What is the Chinese name of 700809-46-7? |
| A: Chinese name of 700809-46-7 is 700809-46-7. |
| Q: What is the English name of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine? |
| A: The English name of n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine is n3-Benzyl-1-pyridin-2-yl-1h-[1,2,4]triazole-3,5-diamine. |