Nofedone
Modify Date: 2026-07-06 19:49:10
Nofedone structure
|
Common Name | Nofedone | ||
|---|---|---|---|---|
| CAS Number | 70096-13-8 | Molecular Weight | 340.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Nofedone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24N2O3 |
|---|---|
| Molecular Weight | 340.4 |
| InChIKey | KUHVZVZAYMLXGA-UZLBHIALSA-N |
| SMILES | CC(C)NCC(O)COC1c2ccccc2C(=O)N1c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Nofedone? |
| A: The English name of Nofedone is Nofedone. |
| Q: What is the InChIKey of Nofedone? |
| A: InChIKey of Nofedone is KUHVZVZAYMLXGA-UZLBHIALSA-N. |
| Q: What is the SMILES notation of Nofedone? |
| A: SMILES notation of Nofedone is CC(C)NCC(O)COC1c2ccccc2C(=O)N1c1ccccc1. |
| Q: What is the Chinese name of 70096-13-8? |
| A: Chinese name of 70096-13-8 is 70096-13-8. |
| Q: What is the CAS number of Nofedone? |
| A: CAS number of Nofedone is 70096-13-8. |
| Q: What is the molecular weight of Nofedone? |
| A: Molecular weight of Nofedone is 340.4. |
| Q: What is the molecular formula of Nofedone? |
| A: Molecular formula of Nofedone is C20H24N2O3. |