chembrdg-bb 6683555 structure
|
Common Name | chembrdg-bb 6683555 | ||
|---|---|---|---|---|
| CAS Number | 70132-77-3 | Molecular Weight | 289.71400 | |
| Density | 1.293g/cm3 | Boiling Point | 459.4ºC at 760 mmHg | |
| Molecular Formula | C15H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.6ºC | |
| Name | chembrdg-bb 6683555 |
|---|
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 459.4ºC at 760 mmHg |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.71400 |
| Flash Point | 231.6ºC |
| Exact Mass | 289.05100 |
| PSA | 62.89000 |
| LogP | 4.61920 |
| Index of Refraction | 1.605 |
| InChIKey | HLJXEMOQJQKXRT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1C |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |