2-ethoxyethyl [3-(diethylamino)phenyl]carbamate structure
|
Common Name | 2-ethoxyethyl [3-(diethylamino)phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 70146-08-6 | Molecular Weight | 280.36300 | |
| Density | 1.096g/cm3 | Boiling Point | 367.1ºC at 760 mmHg | |
| Molecular Formula | C15H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.8ºC | |
| Name | 2-ethoxyethyl N-[3-(diethylamino)phenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 367.1ºC at 760 mmHg |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.36300 |
| Flash Point | 175.8ºC |
| Exact Mass | 280.17900 |
| PSA | 54.29000 |
| LogP | 3.13140 |
| Index of Refraction | 1.55 |
| InChIKey | RZHNDBVTCQOYCF-UHFFFAOYSA-N |
| SMILES | CCOCCOC(=O)Nc1cccc(N(CC)CC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-ethoxyethyl[3-(diethylamino)phenyl]carbamate |