5-chloro-2-[(p-tolyl)sulphonyl]aniline structure
|
Common Name | 5-chloro-2-[(p-tolyl)sulphonyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 70146-09-7 | Molecular Weight | 281.75800 | |
| Density | 1.352g/cm3 | Boiling Point | 470.3ºC at 760 mmHg | |
| Molecular Formula | C13H12ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.2ºC | |
| Name | 5-chloro-2-[(p-tolyl)sulphonyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 470.3ºC at 760 mmHg |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.75800 |
| Flash Point | 238.2ºC |
| Exact Mass | 281.02800 |
| PSA | 68.54000 |
| LogP | 4.72540 |
| Index of Refraction | 1.621 |
| InChIKey | YDSSEPWFAJNLSK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Cl)cc2N)cc1 |
| HS Code | 2921420090 |
|---|
|
~%
5-chloro-2-[(p-... CAS#:70146-09-7 |
| Literature: Loudon; Robson Journal of the Chemical Society, 1937 , p. 242,245 |
|
~%
5-chloro-2-[(p-... CAS#:70146-09-7 |
| Literature: Loudon; Robson Journal of the Chemical Society, 1937 , p. 242,245 |
|
~%
5-chloro-2-[(p-... CAS#:70146-09-7 |
| Literature: Loudon; Robson Journal of the Chemical Society, 1937 , p. 242,245 |
|
~%
5-chloro-2-[(p-... CAS#:70146-09-7 |
| Literature: Loudon; Robson Journal of the Chemical Society, 1937 , p. 242,245 |
|
~%
5-chloro-2-[(p-... CAS#:70146-09-7 |
| Literature: Loudon; Robson Journal of the Chemical Society, 1937 , p. 242,245 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Amino-4-chloro-4'-methyldiphenylsulfone |
| 5-Chlor-2-(toluol-4-sulfonyl)-anilin |
| 5-Chlor-2-p-tolylsulfon-anilin |
| 5-chloro-2-tosylbenzenamine |
| (2-Amino-4-chlorophenyl)(4-methylphenyl) sulfone |
| (4-Chlor-2-amino-phenyl)-p-tolyl-sulfon |
| 5-chloro-2-(toluene-4-sulfonyl)-aniline |
| 5-chloro-2-[(p-tolyl)sulfonyl]aniline |