2,6-diphenyl-4H-1,3,4-thiadiazin-5-one structure
|
Common Name | 2,6-diphenyl-4H-1,3,4-thiadiazin-5-one | ||
|---|---|---|---|---|
| CAS Number | 70156-56-8 | Molecular Weight | 268.33400 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-diphenyl-4H-1,3,4-thiadiazin-5-one |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.33400 |
| Exact Mass | 268.06700 |
| PSA | 66.76000 |
| LogP | 2.71690 |
| Index of Refraction | 1.674 |
| InChIKey | SXBQMAWKMNGHBO-UHFFFAOYSA-N |
| SMILES | O=C1NN=C(c2ccccc2)SC1c1ccccc1 |
|
~%
2,6-diphenyl-4H... CAS#:70156-56-8 |
| Literature: Reeve,W.; Coley,W.R. Canadian Journal of Chemistry, 1979 , vol. 57, p. 444 - 449 |
|
~%
2,6-diphenyl-4H... CAS#:70156-56-8 |
| Literature: Reeve,W.; Coley,W.R. Canadian Journal of Chemistry, 1979 , vol. 57, p. 444 - 449 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |