3-nitro-N-(oxomethylidene)benzenesulfonamide
3-nitro-N-(oxomethylidene)benzenesulfonamide structure
|
Common Name | 3-nitro-N-(oxomethylidene)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7018-79-3 | Molecular Weight | 228.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Nitro-N-(oxomethylidene)benzenesulfonamide (Chinese name: 3-硝基-N-(氧甲基亚胺基)苯磺酰胺, CAS number: 7018-79-3, molecular formula: C7H4N2O5S, molecular weight: 228.18200), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-nitro-N-(oxomethylidene)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H4N2O5S |
|---|---|
| Molecular Weight | 228.18200 |
| Exact Mass | 227.98400 |
| PSA | 117.77000 |
| LogP | 2.22330 |
| InChIKey | JOUQRBQVLURJGK-UHFFFAOYSA-N |
| SMILES | O=C=NS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-nitro-N-(oxom... CAS#:7018-79-3 |
| Literature: Ulrich,H.; Sayigh,A.A.R. Angewandte Chemie, 1966 , vol. 78, p. 761 - 769 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Nitro-benzolsulfonylisocyanat |
| m-Nitrophenylsulfonylisocyanat |
| Benzenesulfonyl isocyanate,3-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3-nitro-N-(oxomethylidene)benzenesulfonamide have? |
| A: English synonyms of 3-nitro-N-(oxomethylidene)benzenesulfonamide: 3-Nitro-benzolsulfonylisocyanat, m-Nitrophenylsulfonylisocyanat, Benzenesulfonyl isocyanate,3-nitro. |
| Q: What is the InChIKey of 3-nitro-N-(oxomethylidene)benzenesulfonamide? |
| A: InChIKey of 3-nitro-N-(oxomethylidene)benzenesulfonamide is JOUQRBQVLURJGK-UHFFFAOYSA-N. |
| Q: What is the LogP of 3-nitro-N-(oxomethylidene)benzenesulfonamide? |
| A: LogP of 3-nitro-N-(oxomethylidene)benzenesulfonamide is 2.22330. |
| Q: What is the molecular weight of 3-nitro-N-(oxomethylidene)benzenesulfonamide? |
| A: Molecular weight of 3-nitro-N-(oxomethylidene)benzenesulfonamide is 228.18200. |
| Q: What is the polar surface area (PSA) of 3-nitro-N-(oxomethylidene)benzenesulfonamide? |
| A: Polar surface area (PSA) of 3-nitro-N-(oxomethylidene)benzenesulfonamide is 117.77000. |
| Q: What is the CAS number of 3-nitro-N-(oxomethylidene)benzenesulfonamide? |
| A: CAS number of 3-nitro-N-(oxomethylidene)benzenesulfonamide is 7018-79-3. |
| Q: What are the upstream materials of 3-nitro-N-(oxomethylidene)benzenesulfonamide? |
| A: Related upstream materials(CAS) of 3-nitro-N-(oxomethylidene)benzenesulfonamide: 75-44-5;121-52-8. |
| Q: What is the English name of 3-nitro-N-(oxomethylidene)benzenesulfonamide? |
| A: The English name of 3-nitro-N-(oxomethylidene)benzenesulfonamide is 3-nitro-N-(oxomethylidene)benzenesulfonamide. |
| Q: What is the SMILES notation of 3-nitro-N-(oxomethylidene)benzenesulfonamide? |
| A: SMILES notation of 3-nitro-N-(oxomethylidene)benzenesulfonamide is O=C=NS(=O)(=O)c1cccc([N+](=O)[O-])c1. |
| Q: What is the molecular formula of 3-nitro-N-(oxomethylidene)benzenesulfonamide? |
| A: Molecular formula of 3-nitro-N-(oxomethylidene)benzenesulfonamide is C7H4N2O5S. |