2,4-diamino-6-phenylpyrimidine-5-carbonitrile structure
|
Common Name | 2,4-diamino-6-phenylpyrimidine-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 70183-20-9 | Molecular Weight | 211.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,4-Diamino-6-phenylpyrimidine-5-carbonitrile (Chinese name: 2,4-二氨基-6-苯基嘧啶-5-氰基), CAS number: 70183-20-9, molecular formula: C11H9N5, molecular weight: 211.22300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-diamino-6-phenylpyrimidine-5-carbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9N5 |
|---|---|
| Molecular Weight | 211.22300 |
| Exact Mass | 211.08600 |
| PSA | 103.07000 |
| LogP | 1.03988 |
| InChIKey | GYCFUXMFRNMXHJ-UHFFFAOYSA-N |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4-Diamino-5-cyan-6-phenyl-pyrimidin |
| 4-(4-chlorophenyl)-6-oxo-2-phenyl-1,6-dihydro-5-pyrimidinecarbonitrile |
| 2,6-Diamino-4-phenylpyrimidine-5-carbonitrile |
| 5-Pyrimidinecarbonitrile,2,4-diamino-6-phenyl |
| 2,4-Diamino-6-phenyl-pyrimidin-5-carbonitril |
| 2,4-diamino-6-phenyl-pyrimidine-5-carbonitrile |
| 2,4-diamino-6-phenyl-5-pyrimidinecarbonitrile |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile? |
| A: LogP of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile is 1.03988. |
| Q: What is the molecular weight of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile? |
| A: Molecular weight of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile is 211.22300. |
| Q: What is the SMILES notation of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile? |
| A: SMILES notation of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile is N#Cc1c(N)nc(N)nc1-c1ccccc1. |
| Q: What is the Chinese name of 70183-20-9? |
| A: Chinese name of 70183-20-9 is 70183-20-9. |
| Q: What is the molecular formula of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile? |
| A: Molecular formula of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile is C11H9N5. |
| Q: What is the polar surface area (PSA) of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile? |
| A: Polar surface area (PSA) of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile is 103.07000. |
| Q: What are the upstream materials of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile? |
| A: Related upstream materials(CAS) of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile: 593-85-1;100-52-7;109-77-3;50-01-1;2700-22-3;3336-65-0;124-46-9;111509-91-2;46177-21-3. |
| Q: What is the InChIKey of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile? |
| A: InChIKey of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile is GYCFUXMFRNMXHJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile? |
| A: CAS number of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile is 70183-20-9. |
| Q: What English synonyms does 2,4-diamino-6-phenylpyrimidine-5-carbonitrile have? |
| A: English synonyms of 2,4-diamino-6-phenylpyrimidine-5-carbonitrile: 2,4-Diamino-5-cyan-6-phenyl-pyrimidin, 4-(4-chlorophenyl)-6-oxo-2-phenyl-1,6-dihydro-5-pyrimidinecarbonitrile, 2,6-Diamino-4-phenylpyrimidine-5-carbonitrile, 5-Pyrimidinecarbonitrile,2,4-diamino-6-phenyl, 2,4-Diamino-6-phenyl-pyrimidin-5-carbonitril, 2,4-diamino-6-phenyl-pyrimidine-5-carbonitrile, 2,4-diamino-6-phenyl-5-pyrimidinecarbonitrile. |