2,5-bis-Acetoacetamidobenzene sulfonic acid
2,5-bis-Acetoacetamidobenzene sulfonic acid structure
|
Common Name | 2,5-bis-Acetoacetamidobenzene sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 70185-87-4 | Molecular Weight | 356.35100 | |
| Density | 1.493g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.493g/cm3 |
|---|---|
| Molecular Formula | C14H16N2O7S |
| Molecular Weight | 356.35100 |
| Exact Mass | 356.06800 |
| PSA | 155.09000 |
| LogP | 1.99530 |
| Index of Refraction | 1.602 |
| InChIKey | DIOSHTLNZVXJOF-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1ccc(NC(=O)CC(C)=O)c(S(=O)(=O)O)c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| l084 |
| MFCD04972525 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid? |
| A: The English name of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid is 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid. |
| Q: What is the polar surface area (PSA) of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid? |
| A: Polar surface area (PSA) of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid is 155.09000. |
| Q: What English synonyms does 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid have? |
| A: English synonyms of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid: l084, MFCD04972525. |
| Q: What is the molecular weight of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid? |
| A: Molecular weight of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid is 356.35100. |
| Q: What is the InChIKey of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid? |
| A: InChIKey of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid is DIOSHTLNZVXJOF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid? |
| A: Molecular formula of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid is C14H16N2O7S. |
| Q: What is the SMILES notation of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid? |
| A: SMILES notation of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid is CC(=O)CC(=O)Nc1ccc(NC(=O)CC(C)=O)c(S(=O)(=O)O)c1. |
| Q: What is the CAS number of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid? |
| A: CAS number of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid is 70185-87-4. |
| Q: What is the LogP of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid? |
| A: LogP of 2,5-bis(3-oxobutanoylamino)benzenesulfonic acid is 1.99530. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |