5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole
5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole structure
|
Common Name | 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole | ||
|---|---|---|---|---|
| CAS Number | 70216-32-9 | Molecular Weight | 281.30600 | |
| Density | 1.153g/cm3 | Boiling Point | 432.468ºC at 760 mmHg | |
| Molecular Formula | C17H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.349ºC | |
Summary: 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole (Chinese name: 5-(3,4-二甲氧基苯基)-2-苯基-1,3-恶唑, CAS number: 70216-32-9, molecular formula: C17H15NO3, molecular weight: 281.30600) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 432.468ºC at 760 mmHg |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.30600 |
| Flash Point | 215.349ºC |
| Exact Mass | 281.10500 |
| PSA | 44.49000 |
| LogP | 4.02580 |
| Index of Refraction | 1.562 |
| InChIKey | VABIMQUXFWWAPI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cnc(-c3ccccc3)o2)cc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:108-86-1
CAS#:73663-61-3
CAS#:591-50-4![N-[(Z)-2-(3,4-dimethoxyphenyl)ethenyl]benzamide Structure](https://image.chemsrc.com/caspic/242/128737-83-7.png)
CAS#:128737-83-7
CAS#:39819-39-1
CAS#:2859-78-1
CAS#:120-14-9
CAS#:70216-33-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-(3,4-Dimethoxyphenyl)-2-phenyloxazol |
| Balsoxin |
| Balsoxine |
| 2-Phenyl-5-(3,4-dimethoxyphenyl)oxazole |
| 5-(3,4-dimethoxy-phenyl)-2-phenyl-oxazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole? |
| A: Related upstream materials(CAS) of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole: 108-86-1;73663-61-3;591-50-4;128737-83-7;39819-39-1;2859-78-1;120-14-9;70216-33-0. |
| Q: What is the English name of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole? |
| A: The English name of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole is 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole. |
| Q: What is the Chinese name of 70216-32-9? |
| A: Chinese name of 70216-32-9 is 70216-32-9. |
| Q: What is the polar surface area (PSA) of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole? |
| A: Polar surface area (PSA) of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole is 44.49000. |
| Q: What English synonyms does 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole have? |
| A: English synonyms of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole: 5-(3,4-Dimethoxyphenyl)-2-phenyloxazol, Balsoxin, Balsoxine, 2-Phenyl-5-(3,4-dimethoxyphenyl)oxazole, 5-(3,4-dimethoxy-phenyl)-2-phenyl-oxazole. |
| Q: What is the LogP of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole? |
| A: LogP of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole is 4.02580. |
| Q: What is the boiling point of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole? |
| A: Boiling point of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole is 432.468ºC at 760 mmHg. |
| Q: What is the SMILES notation of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole? |
| A: SMILES notation of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole is COc1ccc(-c2cnc(-c3ccccc3)o2)cc1OC. |
| Q: What is the molecular formula of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole? |
| A: Molecular formula of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole is C17H15NO3. |
| Q: What is the molecular weight of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole? |
| A: Molecular weight of 5-(3,4-dimethoxyphenyl)-2-phenyl-1,3-oxazole is 281.30600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |