bis(2-hydroxyethyl)ammonium 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulphonate structure
|
Common Name | bis(2-hydroxyethyl)ammonium 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulphonate | ||
|---|---|---|---|---|
| CAS Number | 70225-17-1 | Molecular Weight | 455.24300 | |
| Density | N/A | Boiling Point | 418.9ºC at 760 mmHg | |
| Molecular Formula | C9H12F11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.2ºC | |
| Name | 2-(2-hydroxyethylamino)ethanol,1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 418.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C9H12F11NO5S |
| Molecular Weight | 455.24300 |
| Flash Point | 207.2ºC |
| Exact Mass | 455.02600 |
| PSA | 115.24000 |
| LogP | 2.96750 |
| InChIKey | YCMYOAOBWUIFST-UHFFFAOYSA-N |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.OCC[NH2+]CCO |
| Bis(2-hydroxyethyl)ammonium 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulphonate |
| 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonic acid-2,2'-iminodiethanol (1:1) |
| 1-Pentanesulfonic acid,1,1,2,2,3,3,4,4,5,5,5-undecafluoro-,compd. with 2,2'-iminobis(ethanol) (1:1) |
| Undecafluoro-1-pentanesulfonic acid,compd. with diethanolamine |
| EINECS 274-463-4 |