1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulphonic acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulphonic acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 70225-18-2 | Molecular Weight | 405.23500 | |
| Density | N/A | Boiling Point | 415.9ºC at 760 mmHg | |
| Molecular Formula | C8H12F9NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3ºC | |
| Name | 2-(2-hydroxyethylamino)ethanol,1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 415.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H12F9NO5S |
| Molecular Weight | 405.23500 |
| Flash Point | 205.3ºC |
| Exact Mass | 405.02900 |
| PSA | 115.24000 |
| LogP | 2.33220 |
| InChIKey | HOHGVZJHMJGPDP-UHFFFAOYSA-N |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.OCC[NH2+]CCO |
| 1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-sulphonic acid,compound with2,2'-iminodiethanol (1:1) |
| EINECS 274-465-5 |
| 1-Butanesulfonic acid,1,1,2,2,3,3,4,4,4-nonafluoro-,compd. with 2,2'-iminobis(ethanol) (1:1) |
| Nonafluoro-1-butanesulfonic acid,compd. with diethanolamine |
| 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid-2,2'-iminodiethanol (1:1) |