[4-[(E)-3-(4-acetyloxyphenyl)but-2-en-2-yl]phenyl] acetate structure
|
Common Name | [4-[(E)-3-(4-acetyloxyphenyl)but-2-en-2-yl]phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 70244-12-1 | Molecular Weight | 324.37000 | |
| Density | 1.127g/cm3 | Boiling Point | 436.6ºC at 760 mmHg | |
| Molecular Formula | C20H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.4ºC | |
| Name | [4-[(E)-3-(4-acetyloxyphenyl)but-2-en-2-yl]phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 436.6ºC at 760 mmHg |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.37000 |
| Flash Point | 214.4ºC |
| Exact Mass | 324.13600 |
| PSA | 52.60000 |
| LogP | 4.48780 |
| Index of Refraction | 1.559 |
| InChIKey | DEZMXODPBGGPOX-BUHFOSPRSA-N |
| SMILES | CC(=O)Oc1ccc(C(C)=C(C)c2ccc(OC(C)=O)cc2)cc1 |
|
~63%
[4-[(E)-3-(4-ac... CAS#:70244-12-1 |
| Literature: Castedo, Luis; Saa, Jose M.; Suau, Rafael; Tojo, Gabriel Journal of Organic Chemistry, 1981 , vol. 46, # 21 p. 4292 - 4294 |
| trans-Dimethylstilboestrol diacetate |
| trans-Dms-diacetate |
| 2,3-bis-(4-acetoxy-phenyl)-but-2t-ene |
| trans-Dimethylstilbestrol diacetate |