1-(2,4-dichlorophenyl)-2H-tetrazole-5-thione structure
|
Common Name | 1-(2,4-dichlorophenyl)-2H-tetrazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 7025-15-2 | Molecular Weight | 247.10400 | |
| Density | 1.75g/cm3 | Boiling Point | 321.6ºC at 760 mmHg | |
| Molecular Formula | C7H4Cl2N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.3ºC | |
| Name | 1-(2,4-dichlorophenyl)-2H-tetrazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 321.6ºC at 760 mmHg |
| Molecular Formula | C7H4Cl2N4S |
| Molecular Weight | 247.10400 |
| Flash Point | 148.3ºC |
| Exact Mass | 245.95300 |
| PSA | 78.59000 |
| LogP | 2.63170 |
| Index of Refraction | 1.787 |
| InChIKey | KNXXWYFEFQMLGP-UHFFFAOYSA-N |
| SMILES | S=c1nn[nH]n1-c1ccc(Cl)cc1Cl |
|
~%
1-(2,4-dichloro... CAS#:7025-15-2 |
| Literature: Lieber; Ramachandran Canadian Journal of Chemistry, 1959 , vol. 37, p. 101,105 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
| 1-(2,4-dichloro-phenyl)-1,4-dihydro-tetrazole-5-thione |
| 1-(2,4-dichlorophenyl)-4,5-dihydro-1H-1,2,3,4-tetraazole-5-thione |
| 1-(2.4-Dichlorphenyl)-2-tetrazolin-5-thion |
| 1-(2,4-Dichlor-phenyl)-1,4-dihydro-tetrazolthion |