ethyl 4-(2-hydroxyimino-2-phenyl-ethyl)-5-methyl-1H-pyrazole-3-carboxylate structure
|
Common Name | ethyl 4-(2-hydroxyimino-2-phenyl-ethyl)-5-methyl-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 70291-71-3 | Molecular Weight | 287.31400 | |
| Density | 1.24g/cm3 | Boiling Point | 541.3ºC at 760 mmHg | |
| Molecular Formula | C15H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.2ºC | |
| Name | ethyl 4-[(2Z)-2-hydroxyimino-2-phenylethyl]-5-methyl-1H-pyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 541.3ºC at 760 mmHg |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.31400 |
| Flash Point | 281.2ºC |
| Exact Mass | 287.12700 |
| PSA | 87.57000 |
| LogP | 2.31580 |
| Index of Refraction | 1.596 |
| InChIKey | HJNFZDAYEZIZIR-AQTBWJFISA-N |
| SMILES | CCOC(=O)c1n[nH]c(C)c1CC(=NO)c1ccccc1 |
| 4-(2-hydroxyimino-2-phenyl-ethyl)-5-methyl-1(2)H-pyrazole-3-carboxylic acid ethyl ester |
| oxime of 3-(5)methyl-4-phenacyl-5-(3)carboethoxypyrazole |
| 4-Phenacyl-3-methyl-5-carbethoxypyrazol-oxim |