1-(2,5-dimethoxy-4-nitro-phenyl)ethanone structure
|
Common Name | 1-(2,5-dimethoxy-4-nitro-phenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 70313-21-2 | Molecular Weight | 225.19800 | |
| Density | 1.245g/cm3 | Boiling Point | 374.1ºC at 760mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.8ºC | |
| Name | 1-(2,5-dimethoxy-4-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 374.1ºC at 760mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 174.8ºC |
| Exact Mass | 225.06400 |
| PSA | 81.35000 |
| LogP | 2.33780 |
| InChIKey | CJOQYAAZHIEKPX-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1C(C)=O |
| HS Code | 2914700090 |
|---|
|
~%
1-(2,5-dimethox... CAS#:70313-21-2 |
| Literature: Kawai et al. Nippon Kagaku Zasshi, 1959 , vol. 80, p. 795,796 Chem.Abstr., 1961 , p. 3555 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,5-Dimethoxy-4-nitro-acetophenon |
| 1-(2,5-Dimethoxy-4-nitro-phenyl)-aethanon |
| 1-(2,5-dimethoxy-4-nitro-phenyl)-ethanone |