2,3-dibromo-3-(2-nitrophenyl)propanoic acid structure
|
Common Name | 2,3-dibromo-3-(2-nitrophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 70321-33-4 | Molecular Weight | 352.96400 | |
| Density | 2.043g/cm3 | Boiling Point | 424.8ºC at 760 mmHg | |
| Molecular Formula | C9H7Br2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.7ºC | |
| Name | 2,3-dibromo-3-(2-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.043g/cm3 |
|---|---|
| Boiling Point | 424.8ºC at 760 mmHg |
| Molecular Formula | C9H7Br2NO4 |
| Molecular Weight | 352.96400 |
| Flash Point | 210.7ºC |
| Exact Mass | 350.87400 |
| PSA | 83.12000 |
| LogP | 3.40210 |
| Index of Refraction | 1.662 |
| InChIKey | ZZBGCCIQPYEBFF-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Br)C(Br)c1ccccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Nitro-zimtsaeuredibromid |