2,3,3',4,5'-Pentachlorobiphenyl
2,3,3',4,5'-Pentachlorobiphenyl structure
|
Common Name | 2,3,3',4,5'-Pentachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 70362-41-3 | Molecular Weight | 326.43300 | |
| Density | 1.522 g/cm3 | Boiling Point | 393.3ºC at 760 mmHg | |
| Molecular Formula | C12H5Cl5 | Melting Point | 95.86°C (estimate) | |
| MSDS | N/A | Flash Point | 194.3ºC | |
Summary: 2,3,3',4,5'-Pentachlorobiphenyl (CAS: 70362-41-3) has a molecular formula of C12H5Cl5 and a molecular weight of 326.43300. The melting point is approximately 95.86°C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,3',4,5'-Pentachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.522 g/cm3 |
|---|---|
| Boiling Point | 393.3ºC at 760 mmHg |
| Melting Point | 95.86°C (estimate) |
| Molecular Formula | C12H5Cl5 |
| Molecular Weight | 326.43300 |
| Flash Point | 194.3ºC |
| Exact Mass | 323.88300 |
| LogP | 6.62060 |
| Index of Refraction | 1.619 |
| InChIKey | MPCDNZSLJWJDNW-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(-c2ccc(Cl)c(Cl)c2Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,3,3',4,5'-Pen... CAS#:70362-41-3 |
| Literature: Chemosphere, , vol. 31, # 2 p. 2687 - 2705 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2,3-trichloro-4-(3,5-dichlorophenyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of 2,3,3',4,5'-Pentachlorobiphenyl? |
| A: Melting point of 2,3,3',4,5'-Pentachlorobiphenyl is 95.86°C (estimate). |
| Q: What is the CAS number of 2,3,3',4,5'-Pentachlorobiphenyl? |
| A: CAS number of 2,3,3',4,5'-Pentachlorobiphenyl is 70362-41-3. |
| Q: What English synonyms does 2,3,3',4,5'-Pentachlorobiphenyl have? |
| A: English synonyms of 2,3,3',4,5'-Pentachlorobiphenyl: 1,2,3-trichloro-4-(3,5-dichlorophenyl)benzene. |
| Q: What is the SMILES notation of 2,3,3',4,5'-Pentachlorobiphenyl? |
| A: SMILES notation of 2,3,3',4,5'-Pentachlorobiphenyl is Clc1cc(Cl)cc(-c2ccc(Cl)c(Cl)c2Cl)c1. |
| Q: What is the InChIKey of 2,3,3',4,5'-Pentachlorobiphenyl? |
| A: InChIKey of 2,3,3',4,5'-Pentachlorobiphenyl is MPCDNZSLJWJDNW-UHFFFAOYSA-N. |
| Q: What is the boiling point of 2,3,3',4,5'-Pentachlorobiphenyl? |
| A: Boiling point of 2,3,3',4,5'-Pentachlorobiphenyl is 393.3ºC at 760 mmHg. |
| Q: What is the molecular formula of 2,3,3',4,5'-Pentachlorobiphenyl? |
| A: Molecular formula of 2,3,3',4,5'-Pentachlorobiphenyl is C12H5Cl5. |
| Q: What is the LogP of 2,3,3',4,5'-Pentachlorobiphenyl? |
| A: LogP of 2,3,3',4,5'-Pentachlorobiphenyl is 6.62060. |
| Q: What is the molecular weight of 2,3,3',4,5'-Pentachlorobiphenyl? |
| A: Molecular weight of 2,3,3',4,5'-Pentachlorobiphenyl is 326.43300. |
| Q: What is the English name of 2,3,3',4,5'-Pentachlorobiphenyl? |
| A: The English name of 2,3,3',4,5'-Pentachlorobiphenyl is 2,3,3',4,5'-Pentachlorobiphenyl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |