N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide structure
|
Common Name | N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 7038-07-5 | Molecular Weight | 640.81000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H44N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C42H44N2O4 |
|---|---|
| Molecular Weight | 640.81000 |
| Exact Mass | 640.33000 |
| PSA | 83.64000 |
| LogP | 10.23010 |
| InChIKey | QATYQXPSNFVLKF-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1ccc(C(NC(=O)C(c2ccccc2)c2ccccc2)NC(=O)C(c2ccccc2)c2ccccc2)cc1OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide? |
| A: LogP of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide is 10.23010. |
| Q: What are the downstream products of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide? |
| A: Related downstream products(CAS) of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide: 30216-51-4;89408-28-6. |
| Q: What is the English name of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide? |
| A: The English name of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide is N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide. |
| Q: What is the molecular formula of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide? |
| A: Molecular formula of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide is C42H44N2O4. |
| Q: What is the molecular weight of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide? |
| A: Molecular weight of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide is 640.81000. |
| Q: What is the Chinese name of 7038-07-5? |
| A: Chinese name of 7038-07-5 is 7038-07-5. |
| Q: What is the CAS number of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide? |
| A: CAS number of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide is 7038-07-5. |
| Q: What is the SMILES notation of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide? |
| A: SMILES notation of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide is CCCCCCOc1ccc(C(NC(=O)C(c2ccccc2)c2ccccc2)NC(=O)C(c2ccccc2)c2ccccc2)cc1OC. |
| Q: What is the InChIKey of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide? |
| A: InChIKey of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide is QATYQXPSNFVLKF-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide? |
| A: Polar surface area (PSA) of N-[[(2,2-diphenylacetyl)amino]-(4-hexoxy-3-methoxyphenyl)methyl]-2,2-diphenylacetamide is 83.64000. |