N-benzyl-4-(4-chlorophenyl)sulfonyl-2-(4-fluorophenyl)-1,3-oxazol-5-amine structure
|
Common Name | N-benzyl-4-(4-chlorophenyl)sulfonyl-2-(4-fluorophenyl)-1,3-oxazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 7038-11-1 | Molecular Weight | 442.89000 | |
| Density | 1.404g/cm3 | Boiling Point | 630.1ºC at 760mmHg | |
| Molecular Formula | C22H16ClFN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.9ºC | |
| Name | N-benzyl-4-(4-chlorophenyl)sulfonyl-2-(4-fluorophenyl)-1,3-oxazol-5-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.404g/cm3 |
|---|---|
| Boiling Point | 630.1ºC at 760mmHg |
| Molecular Formula | C22H16ClFN2O3S |
| Molecular Weight | 442.89000 |
| Flash Point | 334.9ºC |
| Exact Mass | 442.05500 |
| PSA | 80.58000 |
| LogP | 6.73280 |
| Index of Refraction | 1.636 |
| InChIKey | QVVWHAHOHUNACE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1nc(-c2ccc(F)cc2)oc1NCc1ccccc1 |
|
~%
N-benzyl-4-(4-c... CAS#:7038-11-1 |
| Literature: Hallonquist; Hibbert Canadian Journal of Research, 1933 , vol. 8, p. 129,135 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2-Chlormethyl-[1,3]dioxolan-4-yl)-methanol |
| 2-Chlormethyl-4-hydroxymethyl-1,3-dioxolan |
| (2-chloromethyl-[1,3]dioxolan-4-yl)-methanol |