[cyclohexyloxy(methyl)phosphoryl]oxycyclohexane structure
|
Common Name | [cyclohexyloxy(methyl)phosphoryl]oxycyclohexane | ||
|---|---|---|---|---|
| CAS Number | 7040-53-1 | Molecular Weight | 260.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [cyclohexyloxy(methyl)phosphoryl]oxycyclohexane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H25O3P |
|---|---|
| Molecular Weight | 260.31000 |
| Exact Mass | 260.15400 |
| PSA | 45.34000 |
| LogP | 4.50790 |
| InChIKey | RNXRKONDANQYCR-UHFFFAOYSA-N |
| SMILES | CP(=O)(OC1CCCCC1)OC1CCCCC1 |
|
~94%
[cyclohexyloxy(... CAS#:7040-53-1 |
| Literature: Gupta, Arvind K.; Kumar, Rajesh; Dubey, Devendra K.; Kaushik Journal of Chemical Research, 2007 , # 6 p. 328 - 331 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Octanol-water partition coefficient, logP of compound by shake flask method based 31P...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5136325
|
| Dicyclohexyl methylphosphonate |
| Phosphonic acid,methyl-,dicyclohexyl ester |
| Methylphosphonsaeure-dicyclohexylester |
| Dicyclohexyl-methylphosphonat |