Territrem A structure
|
Common Name | Territrem A | ||
|---|---|---|---|---|
| CAS Number | 70407-19-1 | Molecular Weight | 510.53200 | |
| Density | 1.44g/cm3 | Boiling Point | 695ºC at 760 mmHg | |
| Molecular Formula | C28H30O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232ºC | |
Use of Territrem ATerritrem A is a shock-causing mycotoxin isolated from Aspergillus terreus[1]. |
| Name | Territrem A |
|---|
| Description | Territrem A is a shock-causing mycotoxin isolated from Aspergillus terreus[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 695ºC at 760 mmHg |
| Molecular Formula | C28H30O9 |
| Molecular Weight | 510.53200 |
| Flash Point | 232ºC |
| Exact Mass | 510.18900 |
| PSA | 124.66000 |
| LogP | 3.16510 |
| Index of Refraction | 1.654 |
| InChIKey | LCJHAHVVYAVVPA-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cc3c(c(=O)o2)CC2(O)C(C)(CCC4(O)C(C)(C)C=CC(=O)C42C)O3)cc2c1OCO2 |