1-.beta.-D-ribofuranosyl-4-methoxypyrazolo[3,4-d] pyrimidine structure
|
Common Name | 1-.beta.-D-ribofuranosyl-4-methoxypyrazolo[3,4-d] pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 70421-26-0 | Molecular Weight | 282.25300 | |
| Density | 1.84g/cm3 | Boiling Point | 585.9ºC at 760 mmHg | |
| Molecular Formula | C11H14N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.2ºC | |
| Name | 2-(hydroxymethyl)-5-(4-methoxypyrazolo[3,4-d]pyrimidin-1-yl)oxolane-3,4-diol |
|---|
| Density | 1.84g/cm3 |
|---|---|
| Boiling Point | 585.9ºC at 760 mmHg |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.25300 |
| Flash Point | 308.2ºC |
| Exact Mass | 282.09600 |
| PSA | 122.75000 |
| Index of Refraction | 1.773 |
| InChIKey | QZBKCOMGHOXFAF-UHFFFAOYSA-N |
| SMILES | COc1ncnc2c1cnn2C1OC(CO)C(O)C1O |
|
~97%
1-.beta.-D-ribo... CAS#:70421-26-0 |
| Literature: Bhat; Montero; Panzica; Wotring; Townsend Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1165 - 1172 |
|
~%
1-.beta.-D-ribo... CAS#:70421-26-0 |
| Literature: Bhat; Montero; Panzica; Wotring; Townsend Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1165 - 1172 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |