[3-(4-methoxyphenyl)-2-methyl-4-oxo-chromen-7-yl] acetate structure
|
Common Name | [3-(4-methoxyphenyl)-2-methyl-4-oxo-chromen-7-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 70460-66-1 | Molecular Weight | 324.32700 | |
| Density | 1.252g/cm3 | Boiling Point | 484.6ºC at 760 mmHg | |
| Molecular Formula | C19H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.4ºC | |
| Name | [3-(4-methoxyphenyl)-2-methyl-4-oxochromen-7-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 484.6ºC at 760 mmHg |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.32700 |
| Flash Point | 267.4ºC |
| Exact Mass | 324.10000 |
| PSA | 65.74000 |
| LogP | 3.70230 |
| Index of Refraction | 1.586 |
| InChIKey | KGJXTDUSFWAIMJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2c(C)oc3cc(OC(C)=O)ccc3c2=O)cc1 |
|
~%
[3-(4-methoxyph... CAS#:70460-66-1 |
| Literature: Wessely; Lechner Monatshefte fuer Chemie, 1931 , vol. 57, p. 395,403 |
|
~%
[3-(4-methoxyph... CAS#:70460-66-1 |
| Literature: Wessely; Lechner Monatshefte fuer Chemie, 1931 , vol. 57, p. 395,403 |
|
~%
[3-(4-methoxyph... CAS#:70460-66-1 |
| Literature: Gupta; Seshadri Journal of Scientific and Industrial Research, 1957 , vol. 16 B, p. 116,119 |
|
~%
[3-(4-methoxyph... CAS#:70460-66-1 |
| Literature: Wessely; Lechner Monatshefte fuer Chemie, 1931 , vol. 57, p. 395,403 |
| 2-Methyl-7-acetoxy-4'-methoxy-isoflavon |
| 2-methyl-7-acetyloxy-4'-methoxyisoflavone |