1,4-bis[2-(diethylamino)ethylamino]anthracene-9,10-dione structure
|
Common Name | 1,4-bis[2-(diethylamino)ethylamino]anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 70477-04-2 | Molecular Weight | 436.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H36N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-bis[2-(diethylamino)ethylamino]anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H36N4O2 |
|---|---|
| Molecular Weight | 436.59000 |
| Exact Mass | 436.28400 |
| PSA | 64.68000 |
| LogP | 4.11540 |
| InChIKey | SKFYKJLSKFOQLM-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNc1ccc(NCCN(CC)CC)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,4-Bis((2-(diethylamino)ethyl)amino)-9,10-anthracenedione |
| 1,4-bis(2-diethylaminoethylamino)anthracene-9,10-dione |
| 9,10-Anthracenedione,1,4-bis((2-(diethylamino)ethyl)amino) |