6-[(4-fluorophenyl)methoxy]-2-[(4-methylphenyl)methylidene]-1-benzofuran-3-one structure
|
Common Name | 6-[(4-fluorophenyl)methoxy]-2-[(4-methylphenyl)methylidene]-1-benzofuran-3-one | ||
|---|---|---|---|---|
| CAS Number | 7048-39-7 | Molecular Weight | 360.37800 | |
| Density | 1.291g/cm3 | Boiling Point | 545.5ºC at 760 mmHg | |
| Molecular Formula | C23H17FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.3ºC | |
| Name | 6-[(4-fluorophenyl)methoxy]-2-[(4-methylphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 545.5ºC at 760 mmHg |
| Molecular Formula | C23H17FO3 |
| Molecular Weight | 360.37800 |
| Flash Point | 273.3ºC |
| Exact Mass | 360.11600 |
| PSA | 35.53000 |
| LogP | 5.32930 |
| Index of Refraction | 1.653 |
| InChIKey | VFOVNHUFTPODLT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C=C2Oc3cc(OCc4ccc(F)cc4)ccc3C2=O)cc1 |
|
~71%
6-[(4-fluorophe... CAS#:7048-39-7 |
| Literature: Yum, Eul Kgun; Yang, Ok-Kyung; Kim, Ji-Eun; Park, Hee Jung Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 9 p. 2645 - 2649 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-benzofuran-2-yl-5-methyl-pyridine |
| 2-(2-benzo[b]furanyl)-5-methylpyridine |