L-Leucinamide, N-[(phenylmethoxy)carbonyl]-S-(phenylmethyl)-L-cysteinyl- (9CI) structure
|
Common Name | L-Leucinamide, N-[(phenylmethoxy)carbonyl]-S-(phenylmethyl)-L-cysteinyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 70497-43-7 | Molecular Weight | 457.58600 | |
| Density | 1.197g/cm3 | Boiling Point | 716.7ºC at 760mmHg | |
| Molecular Formula | C24H31N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 387.2ºC | |
| Name | benzyl N-[1-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-3-benzylsulfanyl-1-oxopropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 716.7ºC at 760mmHg |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.58600 |
| Flash Point | 387.2ºC |
| Exact Mass | 457.20400 |
| PSA | 135.82000 |
| LogP | 4.71310 |
| Index of Refraction | 1.579 |
| InChIKey | VJQUIGYOYVRKLG-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(CSCc1ccccc1)NC(=O)OCc1ccccc1)C(N)=O |
|
~%
L-Leucinamide, ... CAS#:70497-43-7 |
| Literature: Stoffel,W.; Craig,L.C. Journal of the American Chemical Society, 1961 , vol. 83, p. 145 - 149 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| BENZYL N-[2-BENZYLSULFANYL-1-[(1-CARBAMOYL-3-METHYL-BUTYL)CARBAMOYL]ETHYL]CARBAMATE |
| Carbobenzoxy-S-benzyl-cysteinyl-leucinamid-(L,L) |