3-(4-methoxyphenyl)inden-1-one
Modify Date: 2025-09-23 11:53:26
3-(4-methoxyphenyl)inden-1-one structure
|
Common Name | 3-(4-methoxyphenyl)inden-1-one | ||
|---|---|---|---|---|
| CAS Number | 705255-91-0 | Molecular Weight | 236.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-methoxyphenyl)inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O2 |
|---|---|
| Molecular Weight | 236.26500 |
| Exact Mass | 236.08400 |
| PSA | 26.30000 |
| LogP | 3.32320 |
| InChIKey | ABYLEGXNLHXSHN-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=CC(=O)c3ccccc32)cc1 |
|
~52%
3-(4-methoxyphe... CAS#:705255-91-0 |
| Literature: Vasilyev, Aleksander V.; Walspurger, Stephane; Pale, Patrick; Sommer, Jean Tetrahedron Letters, 2004 , vol. 45, # 17 p. 3379 - 3381 |
|
~%
3-(4-methoxyphe... CAS#:705255-91-0 |
| Literature: Vasilyev; Walspurger; Haouas; Sommer; Pale; Rudenko Organic and Biomolecular Chemistry, 2004 , vol. 2, # 23 p. 3483 - 3489 |
|
~%
3-(4-methoxyphe... CAS#:705255-91-0 |
| Literature: Vasilyev; Walspurger; Haouas; Sommer; Pale; Rudenko Organic and Biomolecular Chemistry, 2004 , vol. 2, # 23 p. 3483 - 3489 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(4-methoxyphenyl)indenone |
| 1H-Inden-1-one,3-(4-methoxyphenyl) |
| 3-(4-methoxyphenyl)-1H-inden-1-one |