Phosphorodiamidic acid,N,N-bis(2-chloroethyl)-, 4-nitrophenyl ester structure
|
Common Name | Phosphorodiamidic acid,N,N-bis(2-chloroethyl)-, 4-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 70539-67-2 | Molecular Weight | 342.11600 | |
| Density | 1.47g/cm3 | Boiling Point | 481.3ºC at 760 mmHg | |
| Molecular Formula | C10H14Cl2N3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.9ºC | |
| Name | N-[amino-(4-nitrophenoxy)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 481.3ºC at 760 mmHg |
| Molecular Formula | C10H14Cl2N3O4P |
| Molecular Weight | 342.11600 |
| Flash Point | 244.9ºC |
| Exact Mass | 341.01000 |
| PSA | 111.19000 |
| LogP | 4.04350 |
| Index of Refraction | 1.577 |
| InChIKey | RNYWBVCOEMSHJP-UHFFFAOYSA-N |
| SMILES | NP(=O)(Oc1ccc([N+](=O)[O-])cc1)N(CCCl)CCCl |
|
~%
Phosphorodiamid... CAS#:70539-67-2 |
| Literature: Chiu,F.-T. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, p. 802 - 807 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |