4-hydroxyphenethylamino-3-(2-allyl)phenoxypropan-2-ol structure
|
Common Name | 4-hydroxyphenethylamino-3-(2-allyl)phenoxypropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 70580-01-7 | Molecular Weight | 327.41700 | |
| Density | 1.13g/cm3 | Boiling Point | 521.7ºC at 760 mmHg | |
| Molecular Formula | C20H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.3ºC | |
| Name | 4-[2-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]ethyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 521.7ºC at 760 mmHg |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.41700 |
| Flash Point | 269.3ºC |
| Exact Mass | 327.18300 |
| PSA | 61.72000 |
| LogP | 3.08360 |
| Index of Refraction | 1.583 |
| InChIKey | AMCYDDULFHKKTK-UHFFFAOYSA-N |
| SMILES | C=CCc1ccccc1OCC(O)CNCCc1ccc(O)cc1 |
|
~%
4-hydroxyphenet... CAS#:70580-01-7 |
| Literature: Rzeszotarski,W.J. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, # 6 p. 735 - 737 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Tyr-alp |
| 4-Hydroxyphenethylamino-3-(2-allyl)phenoxypropan-2-ol |
| 4-(2-((2-Hydroxy-3-(2-(2-propenyl)phenoxy)propyl)amino)ethyl)phenol |