1-nitro-3-propoxybenzene structure
|
Common Name | 1-nitro-3-propoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 70599-87-0 | Molecular Weight | 181.18900 | |
| Density | 1.144g/cm3 | Boiling Point | 285.7ºC at 760 mmHg | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129ºC | |
| Name | 1-nitro-3-propoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 285.7ºC at 760 mmHg |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.18900 |
| Flash Point | 129ºC |
| Exact Mass | 181.07400 |
| PSA | 55.05000 |
| LogP | 2.90680 |
| Index of Refraction | 1.528 |
| InChIKey | ATCLUTSGXRLRKU-UHFFFAOYSA-N |
| SMILES | CCCOc1cccc([N+](=O)[O-])c1 |
|
~%
1-nitro-3-propo... CAS#:70599-87-0 |
| Literature: Hodgson; Clay Journal of the Chemical Society, 1931 , p. 2097,2103 |
| (3-nitro-phenyl)-propyl ether |
| (3-Nitro-phenyl)-propyl-aether |
| 1-nitro-3-propoxy-benzene |
| Benzene,1-nitro-3-propoxy |
| 3-Nitro-1-propyloxy-benzol |