methyl 4-[2-[(4-methoxycarbonylbenzoyl)amino]ethylcarbamoyl]benzoate structure
|
Common Name | methyl 4-[2-[(4-methoxycarbonylbenzoyl)amino]ethylcarbamoyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 7060-10-8 | Molecular Weight | 384.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-[2-[(4-methoxycarbonylbenzoyl)amino]ethylcarbamoyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H20N2O6 |
|---|---|
| Molecular Weight | 384.38300 |
| Exact Mass | 384.13200 |
| PSA | 110.80000 |
| LogP | 2.20140 |
| InChIKey | ZVJNDEOCNHLFIR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)NCCNC(=O)c2ccc(C(=O)OC)cc2)cc1 |
|
~%
methyl 4-[2-[(4... CAS#:7060-10-8 |
| Literature: Guarda; Parra; Chavez; Belmar; Jimenez; Pasan; Ruiz-Perez Journal of the Chilean Chemical Society, 2012 , vol. 57, # 3 p. 1305 - 1308 |
|
~%
methyl 4-[2-[(4... CAS#:7060-10-8 |
| Literature: Guarda; Parra; Chavez; Belmar; Jimenez; Pasan; Ruiz-Perez Journal of the Chilean Chemical Society, 2012 , vol. 57, # 3 p. 1305 - 1308 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,4,4'-[1,2-ethanediylbis(iminocarbonyl)]bis-,dimethyl ester |
| Bis-(p-carbomethoxybenzoyl)ethylendiamin |
| N,N'-bis-(4-methoxycarbonylbenzoyl)-1,2-ethanediamine |
| N,N'-bis(p-carbomethoxybenzoyl)ethylene diamine |
| N,N'-Di(4-carbomethoxybenzoyl)ethylenediamine |