3-(3-fluorophenyl)-1-(1-pyridin-2-ylethylideneamino)thiourea structure
|
Common Name | 3-(3-fluorophenyl)-1-(1-pyridin-2-ylethylideneamino)thiourea | ||
|---|---|---|---|---|
| CAS Number | 70618-03-0 | Molecular Weight | 288.34300 | |
| Density | 1.25g/cm3 | Boiling Point | 412.4ºC at 760 mmHg | |
| Molecular Formula | C14H13FN4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.2ºC | |
| Name | 1-(3-fluorophenyl)-3-[(E)-1-pyridin-2-ylethylideneamino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 412.4ºC at 760 mmHg |
| Molecular Formula | C14H13FN4S |
| Molecular Weight | 288.34300 |
| Flash Point | 203.2ºC |
| Exact Mass | 288.08400 |
| PSA | 81.40000 |
| LogP | 3.39520 |
| Index of Refraction | 1.621 |
| InChIKey | VCKFVZSNSWYSKQ-ZDLGFXPLSA-N |
| SMILES | CC(=NNC(=S)Nc1cccc(F)c1)c1ccccn1 |
|
~%
3-(3-fluorophen... CAS#:70618-03-0 |
| Literature: The United States of America as represented by the Secretary of the Army Patent: US5281597 A1, 1994 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (1E)-1-(2-Pyridinyl)ethanone N-(3-fluorophenyl)thiosemicarbazone |
| 2-acetylpyridine 4-(3-fluorophenyl)-3-thiosemicarbazone |