cyclohexyl 4-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]benzoate structure
|
Common Name | cyclohexyl 4-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 7062-04-6 | Molecular Weight | 457.44200 | |
| Density | 1.33g/cm3 | Boiling Point | 510.7ºC at 760 mmHg | |
| Molecular Formula | C25H22F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.6ºC | |
| Name | cyclohexyl 4-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 510.7ºC at 760 mmHg |
| Molecular Formula | C25H22F3NO4 |
| Molecular Weight | 457.44200 |
| Flash Point | 262.6ºC |
| Exact Mass | 457.15000 |
| PSA | 72.03000 |
| LogP | 7.09120 |
| Index of Refraction | 1.583 |
| InChIKey | DCJUMQRFKFDIDL-UHFFFAOYSA-N |
| SMILES | O=C(OC1CCCCC1)c1ccc(NC(=O)c2ccc(-c3cccc(C(F)(F)F)c3)o2)cc1 |
|
~%
cyclohexyl 4-[[... CAS#:7062-04-6 |
| Literature: Crary et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 5584,5586 |
|
~%
cyclohexyl 4-[[... CAS#:7062-04-6 |
| Literature: Shvedov,V.I. et al. Zhurnal Organicheskoi Khimii, 1966 , vol. 2, p. 391 - 393,387 - 389 |
| Ethylglyoxal-4-methoxy-phenylhydrazon |
| 2-(4-methoxy-phenylhydrazono)-butyraldehyde |
| Ethylglyoxal-<p-methoxy-phenylhydrazon> |