2-ethylhexyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid,styrene structure
|
Common Name | 2-ethylhexyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 70632-16-5 | Molecular Weight | 388.54000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H36O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethylhexyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H36O4 |
|---|---|
| Molecular Weight | 388.54000 |
| Exact Mass | 388.26100 |
| PSA | 63.60000 |
| LogP | 6.29880 |
| InChIKey | IBCSCZYYWBLFSS-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCC(CC)CCCC.C=Cc1ccccc1 |
| Styrene,2-ethylhexyl methacrylate,methacrylic acid polymer |
| 2-Propenoic acid,2-methyl-,polymer with ethenylbenzene and 2-ethylhexyl 2-methyl-2-propenoate |