4-phenyl-1-propyl-3,5,8-trioxabicyclo[2.2.2]octane structure
|
Common Name | 4-phenyl-1-propyl-3,5,8-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 70637-03-5 | Molecular Weight | 234.29100 | |
| Density | 1.149g/cm3 | Boiling Point | 310.2ºC at 760 mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.5ºC | |
| Name | 4-phenyl-1-propyl-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 310.2ºC at 760 mmHg |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29100 |
| Flash Point | 103.5ºC |
| Exact Mass | 234.12600 |
| PSA | 27.69000 |
| LogP | 2.66040 |
| Index of Refraction | 1.541 |
| InChIKey | PPVVLQQOTAKGFG-UHFFFAOYSA-N |
| SMILES | CCCC12COC(c3ccccc3)(OC1)OC2 |
| Orthobenzoic acid,cyclic ester with 2-(hydroxymethyl)-2-propyl-1,3-propanediol |
| 2,6,7-Trioxabicyclo(2.2.2)octane,1-phenyl-4-propyl |
| 4-PROPYL-1-PHENYL-2,6,7-TRIOXABICYCLO[2.2.2]OCTANE |