6-(4-benzylpiperazin-1-yl)-5-[[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile structure
|
Common Name | 6-(4-benzylpiperazin-1-yl)-5-[[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 7064-25-7 | Molecular Weight | 605.85700 | |
| Density | 1.25g/cm3 | Boiling Point | 600.7ºC at 760mmHg | |
| Molecular Formula | C33H43N5O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.1ºC | |
| Name | 6-(4-benzylpiperazin-1-yl)-5-[[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 600.7ºC at 760mmHg |
| Molecular Formula | C33H43N5O2S2 |
| Molecular Weight | 605.85700 |
| Flash Point | 317.1ºC |
| Exact Mass | 605.28600 |
| PSA | 129.97000 |
| LogP | 6.11898 |
| Index of Refraction | 1.643 |
| InChIKey | CJCKKRHIWAXYCW-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(CCC)c2N2CCN(Cc3ccccc3)CC2)SC1=S |
|
~%
6-(4-benzylpipe... CAS#:7064-25-7 |
| Literature: Murray,B.G.; Turner,A.F. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1338 - 1339 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6,6-dimethyl-hexahydro-pyrrolo[1,2-b]isoxazole-2-carboxylic acid tert-butylamide |
| 6.6-Dimethyl-N-t.-butyl-pyrrolo<1.2-b>isoxazol-2-carbonsaeure-amid |